C18H29NO4 — CID 70263763
1-O-tert-butyl 3-O-methyl (3S,4S)-4-(5-methylcyclohex-3-en-1-yl)pyrrolidine-1,3-dicarboxylate (PubChem CID 70263763) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3S,4S)-4-(5-methylcyclohex-3-en-1-yl)pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3S,4S)-4-(5-methylcyclohex-3-en-1-yl)pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70263763 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3S,4S)-4-(5-methylcyclohex-3-en-1-yl)pyrrolidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C1CC=CC(C)C1 |
| InChI | InChI=1S/C18H29NO4/c1-12-7-6-8-13(9-12)14-10-19(11-15(14)16(20)22-5)17(21)23-18(2,3)4/h6-7,12-15H,8-11H2,1-5H3/t12?,13?,14-,15+/m0/s1 |
| InChIKey | QYRRSRHSXDIPHV-PFSRBDOWSA-N |
| XLogP | 3.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|