C21H28O4 — CID 70263840
2-[(8R,9R,13R,17S)-9-hydroxy-3-methoxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 70263840) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[(8R,9R,13R,17S)-9-hydroxy-3-methoxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(8R,9R,13R,17S)-9-hydroxy-3-methoxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 70263840 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[(8R,9R,13R,17S)-9-hydroxy-3-methoxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | COc1ccc2c(c1)CC[C@@H]1C3CC[C@@H](CC(=O)O)[C@@]3(C)CC[C@]21O |
| InChI | InChI=1S/C21H28O4/c1-20-9-10-21(24)16-8-5-15(25-2)11-13(16)3-6-18(21)17(20)7-4-14(20)12-19(22)23/h5,8,11,14,17-18,24H,3-4,6-7,9-10,12H2,1-2H3,(H,22,23)/t14-,17?,18+,20+,21-/m0/s1 |
| InChIKey | SMNHVGHQKXWVFE-NZSZNJCFSA-N |
| XLogP | 3.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |