C19H23FN4O3S — CID 70264062
2-[[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]sulfanyl]acetic acid (PubChem CID 70264062) has the molecular formula C19H23FN4O3S and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 70264062 |
| Molecular Formula | C19H23FN4O3S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1cc(F)cc2c1OC(CNCCCNc1ncccn1)CC2 |
| InChI | InChI=1S/C19H23FN4O3S/c20-14-9-13-3-4-15(27-18(13)16(10-14)28-12-17(25)26)11-21-5-1-6-22-19-23-7-2-8-24-19/h2,7-10,15,21H,1,3-6,11-12H2,(H,25,26)(H,22,23,24) |
| InChIKey | UWKMCAXZDMKYQF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|