C10H12F3N3O5 — CID 70264293
2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-2-yl]-1H-imidazole-5-carboxamide (PubChem CID 70264293) has the molecular formula C10H12F3N3O5 and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-2-yl]-1H-imidazole-5-carboxamide.
| Compound Name | 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-2-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 70264293 |
| Molecular Formula | C10H12F3N3O5 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-2-yl]-1H-imidazole-5-carboxamide |
| SMILES | NC(=O)c1cnc([C@@H]2O[C@H](C(O)C(F)(F)F)[C@@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C10H12F3N3O5/c11-10(12,13)7(19)5-3(17)4(18)6(21-5)9-15-1-2(16-9)8(14)20/h1,3-7,17-19H,(H2,14,20)(H,15,16)/t3-,4+,5-,6+,7?/m0/s1 |
| InChIKey | ZSVNDBDYULVDGG-GKYMIPFJSA-N |
| XLogP | -1.41 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |