C18H26N2O2S — CID 7026506
1-benzylsulfonyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine (PubChem CID 7026506) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine.
| Compound Name | 1-benzylsulfonyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine |
|---|---|
| PubChem CID | 7026506 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-benzylsulfonyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(C[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H26N2O2S/c21-23(22,16-18-9-5-2-6-10-18)20-13-11-19(12-14-20)15-17-7-3-1-4-8-17/h1-3,5-6,9-10,17H,4,7-8,11-16H2/t17-/m0/s1 |
| InChIKey | MFMJAZWNCUWDQV-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|