C17H26O5 — CID 70265707
ethyl (Z)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]pent-4-enoate (PubChem CID 70265707) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl (Z)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]pent-4-enoate.
| Compound Name | ethyl (Z)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 70265707 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | ethyl (Z)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]pent-4-enoate |
| SMILES | C=CCC1(CC=C)O[C@@H](/C=C\CCC(=O)OCC)[C@@H](CO)O1 |
| InChI | InChI=1S/C17H26O5/c1-4-11-17(12-5-2)21-14(15(13-18)22-17)9-7-8-10-16(19)20-6-3/h4-5,7,9,14-15,18H,1-2,6,8,10-13H2,3H3/b9-7-/t14-,15+/m0/s1 |
| InChIKey | QMTGEJCXDDFROJ-RJXMKIDGSA-N |
| XLogP | 2.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|