C14H26BNO3 — CID 70266279
4-amino-4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol (PubChem CID 70266279) has the molecular formula C14H26BNO3 and a molecular weight of 267.18 g/mol. Its IUPAC name is 4-amino-4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol.
| Compound Name | 4-amino-4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol |
|---|---|
| PubChem CID | 70266279 |
| Molecular Formula | C14H26BNO3 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 4-amino-4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol |
| SMILES | CC1(C)C2C[C@H]1CC1OB(C(N)CCCO)O[C@]12C |
| InChI | InChI=1S/C14H26BNO3/c1-13(2)9-7-10(13)14(3)11(8-9)18-15(19-14)12(16)5-4-6-17/h9-12,17H,4-8,16H2,1-3H3/t9-,10?,11?,12?,14-/m0/s1 |
| InChIKey | FAKLWEPFLDTCQI-XJKRIIPFSA-N |
| XLogP | 1.35 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|