About 2-(chloromethyl)-1,2-thiazol-5-one
2-(chloromethyl)-1,2-thiazol-5-one (PubChem CID 70266497) has the molecular formula C4H4ClNOS
and a molecular weight of 149.60 g/mol. Its IUPAC name is 2-(chloromethyl)-1,2-thiazol-5-one.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,2-thiazol-5-one |
| PubChem CID | 70266497 |
| Molecular Formula | C4H4ClNOS |
| Molecular Weight | 149.60 g/mol |
| Exact Mass | 148.97 |
| IUPAC Name | 2-(chloromethyl)-1,2-thiazol-5-one |
| SMILES | O=c1ccn(CCl)s1 |
| InChI | InChI=1S/C4H4ClNOS/c5-3-6-2-1-4(7)8-6/h1-2H,3H2 |
| InChIKey | FSDFMMNAMNMFQT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,2-thiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,2-thiazol-5-one?
The IUPAC name of 2-(chloromethyl)-1,2-thiazol-5-one (CID 70266497) is 2-(chloromethyl)-1,2-thiazol-5-one.
What is the SMILES notation for 2-(chloromethyl)-1,2-thiazol-5-one?
The canonical SMILES for 2-(chloromethyl)-1,2-thiazol-5-one is O=c1ccn(CCl)s1.
What is the InChIKey of 2-(chloromethyl)-1,2-thiazol-5-one?
The InChIKey is FSDFMMNAMNMFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNOS/c5-3-6-2-1-4(7)8-6/h1-2H,3H2.
What are the key properties of 2-(chloromethyl)-1,2-thiazol-5-one?
2-(chloromethyl)-1,2-thiazol-5-one has a molecular weight of 149.60 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,2-thiazol-5-one is sourced from PubChem (CID 70266497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).