C27H29F2N3O9S2 — CID 70266545
tert-butyl (2S)-2-[(2,4-difluorophenyl)sulfonyl-(2,6-dioxothiomorpholine-3-carbonyl)amino]-3-[4-(dimethylcarbamoyloxy)phenyl]propanoate (PubChem CID 70266545) has the molecular formula C27H29F2N3O9S2 and a molecular weight of 641.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,4-difluorophenyl)sulfonyl-(2,6-dioxothiomorpholine-3-carbonyl)amino]-3-[4-(dimethylcarbamoyloxy)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2,4-difluorophenyl)sulfonyl-(2,6-dioxothiomorpholine-3-carbonyl)amino]-3-[4-(dimethylcarbamoyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 70266545 |
| Molecular Formula | C27H29F2N3O9S2 |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | tert-butyl (2S)-2-[(2,4-difluorophenyl)sulfonyl-(2,6-dioxothiomorpholine-3-carbonyl)amino]-3-[4-(dimethylcarbamoyloxy)phenyl]propanoate |
| SMILES | CN(C)C(=O)Oc1ccc(C[C@@H](C(=O)OC(C)(C)C)N(C(=O)C2NCC(=O)SC2=O)S(=O)(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C27H29F2N3O9S2/c1-27(2,3)41-24(35)19(12-15-6-9-17(10-7-15)40-26(37)31(4)5)32(23(34)22-25(36)42-21(33)14-30-22)43(38,39)20-11-8-16(28)13-18(20)29/h6-11,13,19,22,30H,12,14H2,1-5H3/t19-,22?/m0/s1 |
| InChIKey | OWKXYZCAHZRVEY-YDNXMHBPSA-N |
| XLogP | 2.25 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|