C34H55N5O7S — CID 70266553
2-[(3S,14S,17S)-3-[[1-[(2R)-1,1-dioxothiolan-2-yl]cyclohexyl]carbamoylamino]-2,16-dioxo-1,15-diazabicyclo[15.3.0]icosan-14-yl]-2-oxo-N-prop-2-enylacetamide (PubChem CID 70266553) has the molecular formula C34H55N5O7S and a molecular weight of 677.91 g/mol. Its IUPAC name is 2-[(3S,14S,17S)-3-[[1-[(2R)-1,1-dioxothiolan-2-yl]cyclohexyl]carbamoylamino]-2,16-dioxo-1,15-diazabicyclo[15.3.0]icosan-14-yl]-2-oxo-N-prop-2-enylacetamide.
| Compound Name | 2-[(3S,14S,17S)-3-[[1-[(2R)-1,1-dioxothiolan-2-yl]cyclohexyl]carbamoylamino]-2,16-dioxo-1,15-diazabicyclo[15.3.0]icosan-14-yl]-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 70266553 |
| Molecular Formula | C34H55N5O7S |
| Molecular Weight | 677.91 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | 2-[(3S,14S,17S)-3-[[1-[(2R)-1,1-dioxothiolan-2-yl]cyclohexyl]carbamoylamino]-2,16-dioxo-1,15-diazabicyclo[15.3.0]icosan-14-yl]-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCCCCC[C@H](NC(=O)NC2([C@H]3CCCS3(=O)=O)CCCCC2)C(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C34H55N5O7S/c1-2-22-35-31(42)29(40)25-16-10-7-5-3-4-6-8-11-17-26(32(43)39-23-14-18-27(39)30(41)36-25)37-33(44)38-34(20-12-9-13-21-34)28-19-15-24-47(28,45)46/h2,25-28H,1,3-24H2,(H,35,42)(H,36,41)(H2,37,38,44)/t25-,26-,27-,28+/m0/s1 |
| InChIKey | HJTGAOBDHQAOFA-LAJGZZDBSA-N |
| XLogP | 3.20 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|