About (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide
(E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide (PubChem CID 70267398) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide |
| PubChem CID | 70267398 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide |
| SMILES | C/C(=C\N1CCNCC1C)C(=O)NCc1cn(C)nc1C |
| InChI | InChI=1S/C15H25N5O/c1-11(9-20-6-5-16-7-12(20)2)15(21)17-8-14-10-19(4)18-13(14)3/h9-10,12,16H,5-8H2,1-4H3,(H,17,21)/b11-9+ |
| InChIKey | BFJOTDWJWMOYOX-PKNBQFBNSA-N |
| XLogP | 0.54 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide?
The IUPAC name of (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide (CID 70267398) is (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide?
The canonical SMILES for (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide is C/C(=C\N1CCNCC1C)C(=O)NCc1cn(C)nc1C.
What is the InChIKey of (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide?
The InChIKey is BFJOTDWJWMOYOX-PKNBQFBNSA-N. The full InChI is InChI=1S/C15H25N5O/c1-11(9-20-6-5-16-7-12(20)2)15(21)17-8-14-10-19(4)18-13(14)3/h9-10,12,16H,5-8H2,1-4H3,(H,17,21)/b11-9+.
What are the key properties of (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide?
(E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide has a molecular weight of 291.40 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methyl-3-(2-methylpiperazin-1-yl)prop-2-enamide is sourced from PubChem (CID 70267398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).