C19H29NO6 — CID 70267435
2,6-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]pyridine (PubChem CID 70267435) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2,6-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]pyridine.
| Compound Name | 2,6-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]pyridine |
|---|---|
| PubChem CID | 70267435 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2,6-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]pyridine |
| SMILES | CC1(C)OCC(COCc2cccc(COCC3COC(C)(C)O3)n2)O1 |
| InChI | InChI=1S/C19H29NO6/c1-18(2)23-12-16(25-18)10-21-8-14-6-5-7-15(20-14)9-22-11-17-13-24-19(3,4)26-17/h5-7,16-17H,8-13H2,1-4H3 |
| InChIKey | XEXCUSYWLKMQCS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |