About [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid
[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 70267733) has the molecular formula C7H12BNO2
and a molecular weight of 152.99 g/mol. Its IUPAC name is [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid.
Molecular Properties
| Compound Name | [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid |
| PubChem CID | 70267733 |
| Molecular Formula | C7H12BNO2 |
| Molecular Weight | 152.99 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | CNC1=CC(B(O)O)CC=C1 |
| InChI | InChI=1S/C7H12BNO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2,4-6,9-11H,3H2,1H3 |
| InChIKey | ZJTFGHVPTIOQIX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.99 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The IUPAC name of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid (CID 70267733) is [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid.
What is the SMILES notation for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The canonical SMILES for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid is CNC1=CC(B(O)O)CC=C1.
What is the InChIKey of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The InChIKey is ZJTFGHVPTIOQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BNO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2,4-6,9-11H,3H2,1H3.
What are the key properties of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid has a molecular weight of 152.99 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid is sourced from PubChem (CID 70267733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).