[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid

C7H12BNO2 — CID 70267733

IUPAC[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid
SMILESCNC1=CC(B(O)O)CC=C1
InChIInChI=1S/C7H12BNO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2,4-6,9-11H,3H2,1H3
InChIKeyZJTFGHVPTIOQIX-UHFFFAOYSA-N
MW152.99 g/mol
LogP-0.11
Rot. Bonds2

About [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid

[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 70267733) has the molecular formula C7H12BNO2 and a molecular weight of 152.99 g/mol. Its IUPAC name is [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid.

Molecular Properties

Compound Name[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid
PubChem CID70267733
Molecular FormulaC7H12BNO2
Molecular Weight152.99 g/mol
Exact Mass153.10
IUPAC Name[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid
SMILESCNC1=CC(B(O)O)CC=C1
InChIInChI=1S/C7H12BNO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2,4-6,9-11H,3H2,1H3
InChIKeyZJTFGHVPTIOQIX-UHFFFAOYSA-N
XLogP-0.11
TPSA52.49 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.99
LogP ≤ 5-0.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The IUPAC name of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid (CID 70267733) is [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid.
What is the SMILES notation for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The canonical SMILES for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid is CNC1=CC(B(O)O)CC=C1.
What is the InChIKey of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
The InChIKey is ZJTFGHVPTIOQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BNO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2,4-6,9-11H,3H2,1H3.
What are the key properties of [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid?
[3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid has a molecular weight of 152.99 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylamino)cyclohexa-2,4-dien-1-yl]boronic acid is sourced from PubChem (CID 70267733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).