C21H20NO3+ — CID 70267784
2,11-dimethoxy-8,10-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-3-ol (PubChem CID 70267784) has the molecular formula C21H20NO3+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 2,11-dimethoxy-8,10-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-3-ol.
| Compound Name | 2,11-dimethoxy-8,10-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
|---|---|
| PubChem CID | 70267784 |
| Molecular Formula | C21H20NO3+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2,11-dimethoxy-8,10-dimethylisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| SMILES | COc1cc2cc3c4cc(OC)c(O)cc4cc[n+]3c(C)c2cc1C |
| InChI | InChI=1S/C21H19NO3/c1-12-7-16-13(2)22-6-5-14-9-19(23)21(25-4)11-17(14)18(22)8-15(16)10-20(12)24-3/h5-11H,1-4H3/p+1 |
| InChIKey | DDXFMADJPCGISE-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|