C25H29FIN7O3 — CID 70268221
N-[(4-fluoro-3-methoxyphenyl)methyl]-4-[2-[[4-[(2-iodoacetyl)amino]cyclohexyl]methyl]tetrazol-5-yl]-6-methylpyridine-2-carboxamide (PubChem CID 70268221) has the molecular formula C25H29FIN7O3 and a molecular weight of 621.46 g/mol. Its IUPAC name is N-[(4-fluoro-3-methoxyphenyl)methyl]-4-[2-[[4-[(2-iodoacetyl)amino]cyclohexyl]methyl]tetrazol-5-yl]-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(4-fluoro-3-methoxyphenyl)methyl]-4-[2-[[4-[(2-iodoacetyl)amino]cyclohexyl]methyl]tetrazol-5-yl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 70268221 |
| Molecular Formula | C25H29FIN7O3 |
| Molecular Weight | 621.46 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | N-[(4-fluoro-3-methoxyphenyl)methyl]-4-[2-[[4-[(2-iodoacetyl)amino]cyclohexyl]methyl]tetrazol-5-yl]-6-methylpyridine-2-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(-c3nnn(CC4CCC(NC(=O)CI)CC4)n3)cc(C)n2)ccc1F |
| InChI | InChI=1S/C25H29FIN7O3/c1-15-9-18(11-21(29-15)25(36)28-13-17-5-8-20(26)22(10-17)37-2)24-31-33-34(32-24)14-16-3-6-19(7-4-16)30-23(35)12-27/h5,8-11,16,19H,3-4,6-7,12-14H2,1-2H3,(H,28,36)(H,30,35) |
| InChIKey | OPGSDYMGSDEJRG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|