About 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate
5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate (PubChem CID 70268678) has the molecular formula C21H17F3N2O6
and a molecular weight of 450.37 g/mol. Its IUPAC name is 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate |
| PubChem CID | 70268678 |
| Molecular Formula | C21H17F3N2O6 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccccn1.COc1ccc(C(=O)O)nc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NO4.C7H7NO2/c1-21-11-6-5-10(13(19)20)18-12(11)22-9-4-2-3-8(7-9)14(15,16)17;1-10-7(9)6-4-2-3-5-8-6/h2-7H,1H3,(H,19,20);2-5H,1H3 |
| InChIKey | XZMTWOVBJJERJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate?
The IUPAC name of 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate (CID 70268678) is 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate.
What is the SMILES notation for 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate?
The canonical SMILES for 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate is COC(=O)c1ccccn1.COc1ccc(C(=O)O)nc1Oc1cccc(C(F)(F)F)c1.
What is the InChIKey of 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate?
The InChIKey is XZMTWOVBJJERJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO4.C7H7NO2/c1-21-11-6-5-10(13(19)20)18-12(11)22-9-4-2-3-8(7-9)14(15,16)17;1-10-7(9)6-4-2-3-5-8-6/h2-7H,1H3,(H,19,20);2-5H,1H3.
What are the key properties of 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate?
5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate has a molecular weight of 450.37 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid;methyl pyridine-2-carboxylate is sourced from PubChem (CID 70268678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).