C23H38O6S — CID 70268993
1-(3-hydroxy-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;sulfuric acid (PubChem CID 70268993) has the molecular formula C23H38O6S and a molecular weight of 442.62 g/mol. Its IUPAC name is 1-(3-hydroxy-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;sulfuric acid.
| Compound Name | 1-(3-hydroxy-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;sulfuric acid |
|---|---|
| PubChem CID | 70268993 |
| Molecular Formula | C23H38O6S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-(3-hydroxy-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanone;sulfuric acid |
| SMILES | CC(=O)C1C(C)CC2C3CC(C)=C4CC(O)CCC4(C)C3CCC21C.O=S(=O)(O)O |
| InChI | InChI=1S/C23H36O2.H2O4S/c1-13-10-17-18(22(4)8-6-16(25)12-19(13)22)7-9-23(5)20(17)11-14(2)21(23)15(3)24;1-5(2,3)4/h14,16-18,20-21,25H,6-12H2,1-5H3;(H2,1,2,3,4) |
| InChIKey | LBWILDDPNKPBSR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|