C22H26IN3O2 — CID 70269254
N-[4-[(1-benzylpyrrolidin-3-yl)amino]-2-iodo-5-methoxyphenyl]cyclopropanecarboxamide (PubChem CID 70269254) has the molecular formula C22H26IN3O2 and a molecular weight of 491.37 g/mol. Its IUPAC name is N-[4-[(1-benzylpyrrolidin-3-yl)amino]-2-iodo-5-methoxyphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(1-benzylpyrrolidin-3-yl)amino]-2-iodo-5-methoxyphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 70269254 |
| Molecular Formula | C22H26IN3O2 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[4-[(1-benzylpyrrolidin-3-yl)amino]-2-iodo-5-methoxyphenyl]cyclopropanecarboxamide |
| SMILES | COc1cc(NC(=O)C2CC2)c(I)cc1NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H26IN3O2/c1-28-21-12-19(25-22(27)16-7-8-16)18(23)11-20(21)24-17-9-10-26(14-17)13-15-5-3-2-4-6-15/h2-6,11-12,16-17,24H,7-10,13-14H2,1H3,(H,25,27) |
| InChIKey | CBPWMLQKUYVFNC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|