C19H22N6O3 — CID 70269386
N-[[3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-4-(2H-tetrazol-5-yl)pyridine-2-carboxamide (PubChem CID 70269386) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[[3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-4-(2H-tetrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | N-[[3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-4-(2H-tetrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70269386 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[[3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-4-(2H-tetrazol-5-yl)pyridine-2-carboxamide |
| SMILES | COCCCOc1cccc(CNC(=O)c2cc(-c3nn[nH]n3)cc(C)n2)c1 |
| InChI | InChI=1S/C19H22N6O3/c1-13-9-15(18-22-24-25-23-18)11-17(21-13)19(26)20-12-14-5-3-6-16(10-14)28-8-4-7-27-2/h3,5-6,9-11H,4,7-8,12H2,1-2H3,(H,20,26)(H,22,23,24,25) |
| InChIKey | CBOFJFQBLSXFNW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|