About (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate
(6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate (PubChem CID 70270342) has the molecular formula C25H23NO4
and a molecular weight of 401.46 g/mol. Its IUPAC name is (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate.
Molecular Properties
| Compound Name | (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate |
| PubChem CID | 70270342 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate |
| SMILES | O=C(OCC1(O)Cc2ccccc2CCC1=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO4/c27-23-16-15-19-9-7-8-10-20(19)17-25(23,29)18-30-24(28)26(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-14,29H,15-18H2 |
| InChIKey | RRAIRQXHIOIASG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate?
The IUPAC name of (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate (CID 70270342) is (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate.
What is the SMILES notation for (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate?
The canonical SMILES for (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate is O=C(OCC1(O)Cc2ccccc2CCC1=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate?
The InChIKey is RRAIRQXHIOIASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO4/c27-23-16-15-19-9-7-8-10-20(19)17-25(23,29)18-30-24(28)26(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-14,29H,15-18H2.
What are the key properties of (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate?
(6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate has a molecular weight of 401.46 g/mol, XLogP of 4.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-hydroxy-7-oxo-8,9-dihydro-5H-benzo[7]annulen-6-yl)methyl N,N-diphenylcarbamate is sourced from PubChem (CID 70270342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).