About 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one
9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one (PubChem CID 70270914) has the molecular formula C20H22N6O2
and a molecular weight of 378.44 g/mol. Its IUPAC name is 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one.
Molecular Properties
| Compound Name | 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one |
| PubChem CID | 70270914 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one |
| SMILES | CCc1ncc2c(=O)[nH]c3c(NCCCOCc4ccccc4)ncnc3n12 |
| InChI | InChI=1S/C20H22N6O2/c1-2-16-22-11-15-20(27)25-17-18(23-13-24-19(17)26(15)16)21-9-6-10-28-12-14-7-4-3-5-8-14/h3-5,7-8,11,13H,2,6,9-10,12H2,1H3,(H,25,27)(H,21,23,24) |
| InChIKey | NTFYVLHOFFXKLA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one?
The IUPAC name of 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one (CID 70270914) is 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one.
What is the SMILES notation for 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one?
The canonical SMILES for 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one is CCc1ncc2c(=O)[nH]c3c(NCCCOCc4ccccc4)ncnc3n12.
What is the InChIKey of 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one?
The InChIKey is NTFYVLHOFFXKLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6O2/c1-2-16-22-11-15-20(27)25-17-18(23-13-24-19(17)26(15)16)21-9-6-10-28-12-14-7-4-3-5-8-14/h3-5,7-8,11,13H,2,6,9-10,12H2,1H3,(H,25,27)(H,21,23,24).
What are the key properties of 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one?
9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one has a molecular weight of 378.44 g/mol, XLogP of 2.55, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-4-(3-phenylmethoxypropylamino)-5H-imidazo[5,1-h]pteridin-6-one is sourced from PubChem (CID 70270914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).