C35H41Cl2N2O3+ — CID 70270936
3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)-1-methylpyridin-1-ium-3-yl]-2-methylphenyl]propan-1-amine (PubChem CID 70270936) has the molecular formula C35H41Cl2N2O3+ and a molecular weight of 608.63 g/mol. Its IUPAC name is 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)-1-methylpyridin-1-ium-3-yl]-2-methylphenyl]propan-1-amine.
| Compound Name | 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)-1-methylpyridin-1-ium-3-yl]-2-methylphenyl]propan-1-amine |
|---|---|
| PubChem CID | 70270936 |
| Molecular Formula | C35H41Cl2N2O3+ |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)-1-methylpyridin-1-ium-3-yl]-2-methylphenyl]propan-1-amine |
| SMILES | COCCCc1c(-c2ccc(C(CN)Cc3ccc(OCCOc4c(Cl)cc(C)cc4Cl)cc3)c(C)c2)ccc[n+]1C |
| InChI | InChI=1S/C35H41Cl2N2O3/c1-24-19-32(36)35(33(37)20-24)42-18-17-41-29-12-9-26(10-13-29)22-28(23-38)30-14-11-27(21-25(30)2)31-7-5-15-39(3)34(31)8-6-16-40-4/h5,7,9-15,19-21,28H,6,8,16-18,22-23,38H2,1-4H3/q+1 |
| InChIKey | UBHWNKNURNQEJF-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|