C14H21N4O4+ — CID 7027114
(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene-[3-(2-oxopyrrolidin-1-yl)propyl]azanium (PubChem CID 7027114) has the molecular formula C14H21N4O4+ and a molecular weight of 309.35 g/mol. Its IUPAC name is (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene-[3-(2-oxopyrrolidin-1-yl)propyl]azanium.
| Compound Name | (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene-[3-(2-oxopyrrolidin-1-yl)propyl]azanium |
|---|---|
| PubChem CID | 7027114 |
| Molecular Formula | C14H21N4O4+ |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene-[3-(2-oxopyrrolidin-1-yl)propyl]azanium |
| SMILES | CN1C(=O)C(/C=[NH+]/CCCN2CCCC2=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H20N4O4/c1-16-12(20)10(13(21)17(2)14(16)22)9-15-6-4-8-18-7-3-5-11(18)19/h9-10H,3-8H2,1-2H3/p+1/b15-9+ |
| InChIKey | XGKUEOVZSSCLNM-OQLLNIDSSA-O |
| XLogP | -2.18 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|