C15H22N2 — CID 70271164
N-(3,4-dihydronaphthalen-1-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 70271164) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-(3,4-dihydronaphthalen-1-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(3,4-dihydronaphthalen-1-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 70271164 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-(3,4-dihydronaphthalen-1-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1=CCCc2ccccc21 |
| InChI | InChI=1S/C15H22N2/c1-17(2)12-6-11-16-15-10-5-8-13-7-3-4-9-14(13)15/h3-4,7,9-10,16H,5-6,8,11-12H2,1-2H3 |
| InChIKey | IDOVLEKZNDTEIK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|