C21H24Cl2N2O — CID 70272096
2,3-dichloro-N-[(R)-(2,5-dimethylpiperidin-2-yl)-phenylmethyl]benzamide (PubChem CID 70272096) has the molecular formula C21H24Cl2N2O and a molecular weight of 391.34 g/mol. Its IUPAC name is 2,3-dichloro-N-[(R)-(2,5-dimethylpiperidin-2-yl)-phenylmethyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(R)-(2,5-dimethylpiperidin-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 70272096 |
| Molecular Formula | C21H24Cl2N2O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2,3-dichloro-N-[(R)-(2,5-dimethylpiperidin-2-yl)-phenylmethyl]benzamide |
| SMILES | CC1CCC(C)([C@H](NC(=O)c2cccc(Cl)c2Cl)c2ccccc2)NC1 |
| InChI | InChI=1S/C21H24Cl2N2O/c1-14-11-12-21(2,24-13-14)19(15-7-4-3-5-8-15)25-20(26)16-9-6-10-17(22)18(16)23/h3-10,14,19,24H,11-13H2,1-2H3,(H,25,26)/t14?,19-,21?/m1/s1 |
| InChIKey | CZNBVJHUFSOCOG-XGMGDGQCSA-N |
| XLogP | 5.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |