C16H21N3O2S — CID 70272422
5-[(2R,5S)-2,5-dimethylpiperazin-1-yl]sulfonyl-4-methylisoquinoline (PubChem CID 70272422) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 5-[(2R,5S)-2,5-dimethylpiperazin-1-yl]sulfonyl-4-methylisoquinoline.
| Compound Name | 5-[(2R,5S)-2,5-dimethylpiperazin-1-yl]sulfonyl-4-methylisoquinoline |
|---|---|
| PubChem CID | 70272422 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 5-[(2R,5S)-2,5-dimethylpiperazin-1-yl]sulfonyl-4-methylisoquinoline |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3C[C@H](C)NC[C@H]3C)c12 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-7-17-9-14-5-4-6-15(16(11)14)22(20,21)19-10-12(2)18-8-13(19)3/h4-7,9,12-13,18H,8,10H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | WNAFWOXBQABQDH-QWHCGFSZSA-N |
| XLogP | 1.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |