C26H25F3N2O5 — CID 70272476
methyl (3S)-3-(1,3-dioxoisoindol-2-yl)-5-[5-methyl-1-(2,4,5-trifluorobenzoyl)pyrrolidin-2-yl]pentanoate (PubChem CID 70272476) has the molecular formula C26H25F3N2O5 and a molecular weight of 502.49 g/mol. Its IUPAC name is methyl (3S)-3-(1,3-dioxoisoindol-2-yl)-5-[5-methyl-1-(2,4,5-trifluorobenzoyl)pyrrolidin-2-yl]pentanoate.
| Compound Name | methyl (3S)-3-(1,3-dioxoisoindol-2-yl)-5-[5-methyl-1-(2,4,5-trifluorobenzoyl)pyrrolidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 70272476 |
| Molecular Formula | C26H25F3N2O5 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | methyl (3S)-3-(1,3-dioxoisoindol-2-yl)-5-[5-methyl-1-(2,4,5-trifluorobenzoyl)pyrrolidin-2-yl]pentanoate |
| SMILES | COC(=O)C[C@H](CCC1CCC(C)N1C(=O)c1cc(F)c(F)cc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H25F3N2O5/c1-14-7-8-15(30(14)26(35)19-12-21(28)22(29)13-20(19)27)9-10-16(11-23(32)36-2)31-24(33)17-5-3-4-6-18(17)25(31)34/h3-6,12-16H,7-11H2,1-2H3/t14?,15?,16-/m0/s1 |
| InChIKey | GDMMILXQRXATIV-GPANFISMSA-N |
| XLogP | 4.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|