About 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine
6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 70272520) has the molecular formula C14H13ClN2
and a molecular weight of 244.72 g/mol. Its IUPAC name is 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine |
| PubChem CID | 70272520 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC1=C(c2ccccc2)NC2C=CC(Cl)=CN12 |
| InChI | InChI=1S/C14H13ClN2/c1-10-14(11-5-3-2-4-6-11)16-13-8-7-12(15)9-17(10)13/h2-9,13,16H,1H3 |
| InChIKey | ALJOOMJNWPXFKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine (CID 70272520) is 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine is CC1=C(c2ccccc2)NC2C=CC(Cl)=CN12.
What is the InChIKey of 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The InChIKey is ALJOOMJNWPXFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2/c1-10-14(11-5-3-2-4-6-11)16-13-8-7-12(15)9-17(10)13/h2-9,13,16H,1H3.
What are the key properties of 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine?
6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine has a molecular weight of 244.72 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-2-phenyl-1,8a-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 70272520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).