C22H26N4O3 — CID 70272698
2-(6-amino-5,7-dioxo-4-phenyl-1,4-diazepan-1-yl)-3-methyl-2-phenylbutanamide (PubChem CID 70272698) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-(6-amino-5,7-dioxo-4-phenyl-1,4-diazepan-1-yl)-3-methyl-2-phenylbutanamide.
| Compound Name | 2-(6-amino-5,7-dioxo-4-phenyl-1,4-diazepan-1-yl)-3-methyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 70272698 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(6-amino-5,7-dioxo-4-phenyl-1,4-diazepan-1-yl)-3-methyl-2-phenylbutanamide |
| SMILES | CC(C)C(C(N)=O)(c1ccccc1)N1CCN(c2ccccc2)C(=O)C(N)C1=O |
| InChI | InChI=1S/C22H26N4O3/c1-15(2)22(21(24)29,16-9-5-3-6-10-16)26-14-13-25(17-11-7-4-8-12-17)19(27)18(23)20(26)28/h3-12,15,18H,13-14,23H2,1-2H3,(H2,24,29) |
| InChIKey | WQDSAKHOJFFVMZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|