About bis(4,5-dihydro-1,3-oxazol-2-yl)diazene
bis(4,5-dihydro-1,3-oxazol-2-yl)diazene (PubChem CID 70272991) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is bis(4,5-dihydro-1,3-oxazol-2-yl)diazene.
Molecular Properties
| Compound Name | bis(4,5-dihydro-1,3-oxazol-2-yl)diazene |
| PubChem CID | 70272991 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | bis(4,5-dihydro-1,3-oxazol-2-yl)diazene |
| SMILES | C1COC(N=NC2=NCCO2)=N1 |
| InChI | InChI=1S/C6H8N4O2/c1-3-11-5(7-1)9-10-6-8-2-4-12-6/h1-4H2 |
| InChIKey | MKQPOLKAKONNRC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(4,5-dihydro-1,3-oxazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,5-dihydro-1,3-oxazol-2-yl)diazene?
The IUPAC name of bis(4,5-dihydro-1,3-oxazol-2-yl)diazene (CID 70272991) is bis(4,5-dihydro-1,3-oxazol-2-yl)diazene.
What is the SMILES notation for bis(4,5-dihydro-1,3-oxazol-2-yl)diazene?
The canonical SMILES for bis(4,5-dihydro-1,3-oxazol-2-yl)diazene is C1COC(N=NC2=NCCO2)=N1.
What is the InChIKey of bis(4,5-dihydro-1,3-oxazol-2-yl)diazene?
The InChIKey is MKQPOLKAKONNRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c1-3-11-5(7-1)9-10-6-8-2-4-12-6/h1-4H2.
What are the key properties of bis(4,5-dihydro-1,3-oxazol-2-yl)diazene?
bis(4,5-dihydro-1,3-oxazol-2-yl)diazene has a molecular weight of 168.16 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,5-dihydro-1,3-oxazol-2-yl)diazene is sourced from PubChem (CID 70272991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).