About bis(1,1-dimorpholin-4-ylethyl) carbonate
bis(1,1-dimorpholin-4-ylethyl) carbonate (PubChem CID 70273238) has the molecular formula C21H38N4O7
and a molecular weight of 458.56 g/mol. Its IUPAC name is bis(1,1-dimorpholin-4-ylethyl) carbonate.
Molecular Properties
| Compound Name | bis(1,1-dimorpholin-4-ylethyl) carbonate |
| PubChem CID | 70273238 |
| Molecular Formula | C21H38N4O7 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | bis(1,1-dimorpholin-4-ylethyl) carbonate |
| SMILES | CC(OC(=O)OC(C)(N1CCOCC1)N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H38N4O7/c1-20(22-3-11-27-12-4-22,23-5-13-28-14-6-23)31-19(26)32-21(2,24-7-15-29-16-8-24)25-9-17-30-18-10-25/h3-18H2,1-2H3 |
| InChIKey | SFZKIOIQDGMLRI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 85.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze bis(1,1-dimorpholin-4-ylethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,1-dimorpholin-4-ylethyl) carbonate?
The IUPAC name of bis(1,1-dimorpholin-4-ylethyl) carbonate (CID 70273238) is bis(1,1-dimorpholin-4-ylethyl) carbonate.
What is the SMILES notation for bis(1,1-dimorpholin-4-ylethyl) carbonate?
The canonical SMILES for bis(1,1-dimorpholin-4-ylethyl) carbonate is CC(OC(=O)OC(C)(N1CCOCC1)N1CCOCC1)(N1CCOCC1)N1CCOCC1.
What is the InChIKey of bis(1,1-dimorpholin-4-ylethyl) carbonate?
The InChIKey is SFZKIOIQDGMLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N4O7/c1-20(22-3-11-27-12-4-22,23-5-13-28-14-6-23)31-19(26)32-21(2,24-7-15-29-16-8-24)25-9-17-30-18-10-25/h3-18H2,1-2H3.
What are the key properties of bis(1,1-dimorpholin-4-ylethyl) carbonate?
bis(1,1-dimorpholin-4-ylethyl) carbonate has a molecular weight of 458.56 g/mol, XLogP of -0.18, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1-dimorpholin-4-ylethyl) carbonate is sourced from PubChem (CID 70273238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).