C18H20N2O4 — CID 70273327
but-2-enedioic acid;(5S)-5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole (PubChem CID 70273327) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is but-2-enedioic acid;(5S)-5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
| Compound Name | but-2-enedioic acid;(5S)-5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 70273327 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | but-2-enedioic acid;(5S)-5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=NC[C@H](CC2=Cc3ccccc3CC2)N1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H16N2.C4H4O4/c1-2-4-13-7-11(5-6-12(13)3-1)8-14-9-15-10-16-14;5-3(6)1-2-4(7)8/h1-4,7,10,14H,5-6,8-9H2,(H,15,16);1-2H,(H,5,6)(H,7,8)/t14-;/m0./s1 |
| InChIKey | KCCWGKLXVFMDKQ-UQKRIMTDSA-N |
| XLogP | 2.12 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|