About terephthalate;bis(triethylazanium)
terephthalate;bis(triethylazanium) (PubChem CID 70273436) has the molecular formula C20H36N2O4
and a molecular weight of 368.52 g/mol. Its IUPAC name is terephthalate;bis(triethylazanium).
Molecular Properties
| Compound Name | terephthalate;bis(triethylazanium) |
| PubChem CID | 70273436 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | terephthalate;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.O=C([O-])c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H6O4.2C6H15N/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-4-7(5-2)6-3/h1-4H,(H,9,10)(H,11,12);2*4-6H2,1-3H3 |
| InChIKey | BIZVUECJOCNKDY-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze terephthalate;bis(triethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of terephthalate;bis(triethylazanium)?
The IUPAC name of terephthalate;bis(triethylazanium) (CID 70273436) is terephthalate;bis(triethylazanium).
What is the SMILES notation for terephthalate;bis(triethylazanium)?
The canonical SMILES for terephthalate;bis(triethylazanium) is CC[NH+](CC)CC.CC[NH+](CC)CC.O=C([O-])c1ccc(C(=O)[O-])cc1.
What is the InChIKey of terephthalate;bis(triethylazanium)?
The InChIKey is BIZVUECJOCNKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C6H15N/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-4-7(5-2)6-3/h1-4H,(H,9,10)(H,11,12);2*4-6H2,1-3H3.
What are the key properties of terephthalate;bis(triethylazanium)?
terephthalate;bis(triethylazanium) has a molecular weight of 368.52 g/mol, XLogP of -1.72, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for terephthalate;bis(triethylazanium) is sourced from PubChem (CID 70273436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).