C32H34F2N4O4 — CID 70273458
bis[5-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazol-2-yl] (E)-but-2-enedioate (PubChem CID 70273458) has the molecular formula C32H34F2N4O4 and a molecular weight of 576.64 g/mol. Its IUPAC name is bis[5-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazol-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[5-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazol-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 70273458 |
| Molecular Formula | C32H34F2N4O4 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | bis[5-[(7-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazol-2-yl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC1=NCC(CC2CCc3ccc(F)cc3C2)N1)OC1=NCC(CC2CCc3ccc(F)cc3C2)N1 |
| InChI | InChI=1S/C32H34F2N4O4/c33-25-7-5-21-3-1-19(11-23(21)15-25)13-27-17-35-31(37-27)41-29(39)9-10-30(40)42-32-36-18-28(38-32)14-20-2-4-22-6-8-26(34)16-24(22)12-20/h5-10,15-16,19-20,27-28H,1-4,11-14,17-18H2,(H,35,37)(H,36,38)/b10-9+ |
| InChIKey | TZRZUMSRQSSXRS-MDZDMXLPSA-N |
| XLogP | 3.95 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|