C19H22N2O4 — CID 70273559
but-2-enedioic acid;5-[(7-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 70273559) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is but-2-enedioic acid;5-[(7-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | but-2-enedioic acid;5-[(7-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 70273559 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | but-2-enedioic acid;5-[(7-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1ccc2c(c1)C=C(CC1CN=CN1)CC2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H18N2.C4H4O4/c1-11-2-4-13-5-3-12(7-14(13)6-11)8-15-9-16-10-17-15;5-3(6)1-2-4(7)8/h2,4,6-7,10,15H,3,5,8-9H2,1H3,(H,16,17);1-2H,(H,5,6)(H,7,8) |
| InChIKey | OPNUFVVOTQYALA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|