C15H20ClF3N4O6S — CID 70274159
2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-methylamino]-2-hydroxyacetamide;2,2,2-trifluoroacetic acid (PubChem CID 70274159) has the molecular formula C15H20ClF3N4O6S and a molecular weight of 476.86 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-methylamino]-2-hydroxyacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-methylamino]-2-hydroxyacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70274159 |
| Molecular Formula | C15H20ClF3N4O6S |
| Molecular Weight | 476.86 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-methylamino]-2-hydroxyacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C(O)C(N)=O)S(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19ClN4O4S.C2HF3O2/c1-16(13(20)12(15)19)23(21,22)18-8-6-17(7-9-18)11-4-2-10(14)3-5-11;3-2(4,5)1(6)7/h2-5,13,20H,6-9H2,1H3,(H2,15,19);(H,6,7) |
| InChIKey | CDJSPZRQQXWMLO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.86 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|