About 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine
2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 70274211) has the molecular formula C10H12N4S
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine |
| PubChem CID | 70274211 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | c1cnc2nc(N3CCNCC3)sc2c1 |
| InChI | InChI=1S/C10H12N4S/c1-2-8-9(12-3-1)13-10(15-8)14-6-4-11-5-7-14/h1-3,11H,4-7H2 |
| InChIKey | HQMNUDXHVWGNNK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine?
The IUPAC name of 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine (CID 70274211) is 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine.
What is the SMILES notation for 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine?
The canonical SMILES for 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine is c1cnc2nc(N3CCNCC3)sc2c1.
What is the InChIKey of 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine?
The InChIKey is HQMNUDXHVWGNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4S/c1-2-8-9(12-3-1)13-10(15-8)14-6-4-11-5-7-14/h1-3,11H,4-7H2.
What are the key properties of 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine?
2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine has a molecular weight of 220.30 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-[1,3]thiazolo[4,5-b]pyridine is sourced from PubChem (CID 70274211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).