C16H16N6O3S — CID 70274596
N-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 70274596) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 70274596 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | CS(=O)(=O)Cc1cc(N)nc(-c2ccc(NC(=O)c3ccn[nH]3)cc2)n1 |
| InChI | InChI=1S/C16H16N6O3S/c1-26(24,25)9-12-8-14(17)21-15(19-12)10-2-4-11(5-3-10)20-16(23)13-6-7-18-22-13/h2-8H,9H2,1H3,(H,18,22)(H,20,23)(H2,17,19,21) |
| InChIKey | YTNFZMQEUMRNID-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |