C20H26O4 — CID 70274927
(4S,9S)-4,9-di(propan-2-yl)-2,11-dioxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-3,10-dione (PubChem CID 70274927) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (4S,9S)-4,9-di(propan-2-yl)-2,11-dioxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-3,10-dione.
| Compound Name | (4S,9S)-4,9-di(propan-2-yl)-2,11-dioxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-3,10-dione |
|---|---|
| PubChem CID | 70274927 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (4S,9S)-4,9-di(propan-2-yl)-2,11-dioxabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-3,10-dione |
| SMILES | CC(C)[C@@H]1CC=CC[C@@H](C(C)C)C(=O)Oc2ccccc2OC1=O |
| InChI | InChI=1S/C20H26O4/c1-13(2)15-9-5-6-10-16(14(3)4)20(22)24-18-12-8-7-11-17(18)23-19(15)21/h5-8,11-16H,9-10H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | JOPHSRZDNICSOT-HOTGVXAUSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|