C15H22O4 — CID 70275099
2,2,3,4-tetramethoxy-1,7,8,9-tetrahydrobenzo[7]annulene (PubChem CID 70275099) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,2,3,4-tetramethoxy-1,7,8,9-tetrahydrobenzo[7]annulene.
| Compound Name | 2,2,3,4-tetramethoxy-1,7,8,9-tetrahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 70275099 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2,2,3,4-tetramethoxy-1,7,8,9-tetrahydrobenzo[7]annulene |
| SMILES | COC1=C(OC)C(OC)(OC)CC2=C1C=CCCC2 |
| InChI | InChI=1S/C15H22O4/c1-16-13-12-9-7-5-6-8-11(12)10-15(18-3,19-4)14(13)17-2/h7,9H,5-6,8,10H2,1-4H3 |
| InChIKey | OCWXCONGSDUUFD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|