C11H17N3 — CID 70275704
3,5-bis(but-3-enyl)-1-methyl-1,2,4-triazole (PubChem CID 70275704) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3,5-bis(but-3-enyl)-1-methyl-1,2,4-triazole.
| Compound Name | 3,5-bis(but-3-enyl)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 70275704 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3,5-bis(but-3-enyl)-1-methyl-1,2,4-triazole |
| SMILES | C=CCCc1nc(CCC=C)n(C)n1 |
| InChI | InChI=1S/C11H17N3/c1-4-6-8-10-12-11(9-7-5-2)14(3)13-10/h4-5H,1-2,6-9H2,3H3 |
| InChIKey | MUTFAFYSGUFUAT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|