About 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid
2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (PubChem CID 70275744) has the molecular formula C22H23BrN4O4
and a molecular weight of 487.35 g/mol. Its IUPAC name is 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| PubChem CID | 70275744 |
| Molecular Formula | C22H23BrN4O4 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(Cc1c[nH]c2ccc(Br)cc12)C(=O)O.N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H11BrN2O2.C11H12N2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-2,4-5,9,14H,3,13H2,(H,15,16);1-4,6,9,13H,5,12H2,(H,14,15)/t;9-/m.1/s1 |
| InChIKey | IGXWUCDEEDIGDB-YYVQYPFISA-N |
| XLogP | 3.01 |
| TPSA | 158.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid?
The IUPAC name of 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CID 70275744) is 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid is NC(Cc1c[nH]c2ccc(Br)cc12)C(=O)O.N[C@H](Cc1c[nH]c2ccccc12)C(=O)O.
What is the InChIKey of 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid?
The InChIKey is IGXWUCDEEDIGDB-YYVQYPFISA-N. The full InChI is InChI=1S/C11H11BrN2O2.C11H12N2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-2,4-5,9,14H,3,13H2,(H,15,16);1-4,6,9,13H,5,12H2,(H,14,15)/t;9-/m.1/s1.
What are the key properties of 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid?
2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid has a molecular weight of 487.35 g/mol, XLogP of 3.01, 6 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid;(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid is sourced from PubChem (CID 70275744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).