C27H28ClN3O — CID 70275764
(2S)-2-amino-N-naphthalen-2-yl-3-phenylpropanamide;2-(3-chlorophenyl)ethanamine (PubChem CID 70275764) has the molecular formula C27H28ClN3O and a molecular weight of 445.99 g/mol. Its IUPAC name is (2S)-2-amino-N-naphthalen-2-yl-3-phenylpropanamide;2-(3-chlorophenyl)ethanamine.
| Compound Name | (2S)-2-amino-N-naphthalen-2-yl-3-phenylpropanamide;2-(3-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 70275764 |
| Molecular Formula | C27H28ClN3O |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (2S)-2-amino-N-naphthalen-2-yl-3-phenylpropanamide;2-(3-chlorophenyl)ethanamine |
| SMILES | NCCc1cccc(Cl)c1.N[C@@H](Cc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H18N2O.C8H10ClN/c20-18(12-14-6-2-1-3-7-14)19(22)21-17-11-10-15-8-4-5-9-16(15)13-17;9-8-3-1-2-7(6-8)4-5-10/h1-11,13,18H,12,20H2,(H,21,22);1-3,6H,4-5,10H2/t18-;/m0./s1 |
| InChIKey | IPLGVAXGVMAFNE-FERBBOLQSA-N |
| XLogP | 5.19 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |