C23H31ClN4O2 — CID 70275982
2-[3-carbamimidoyl-N-(3-methylbut-2-enyl)anilino]-N-(4-propan-2-yloxyphenyl)acetamide;hydrochloride (PubChem CID 70275982) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 2-[3-carbamimidoyl-N-(3-methylbut-2-enyl)anilino]-N-(4-propan-2-yloxyphenyl)acetamide;hydrochloride.
| Compound Name | 2-[3-carbamimidoyl-N-(3-methylbut-2-enyl)anilino]-N-(4-propan-2-yloxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70275982 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[3-carbamimidoyl-N-(3-methylbut-2-enyl)anilino]-N-(4-propan-2-yloxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(N(CC=C(C)C)CC(=O)Nc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C23H30N4O2.ClH/c1-16(2)12-13-27(20-7-5-6-18(14-20)23(24)25)15-22(28)26-19-8-10-21(11-9-19)29-17(3)4;/h5-12,14,17H,13,15H2,1-4H3,(H3,24,25)(H,26,28);1H |
| InChIKey | JEUANZKDRAKDIK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|