About 1,4-dihydropyridine-2,3-dione;iron
1,4-dihydropyridine-2,3-dione;iron (PubChem CID 70276260) has the molecular formula C5H5FeNO2
and a molecular weight of 166.94 g/mol. Its IUPAC name is 1,4-dihydropyridine-2,3-dione;iron.
Molecular Properties
| Compound Name | 1,4-dihydropyridine-2,3-dione;iron |
| PubChem CID | 70276260 |
| Molecular Formula | C5H5FeNO2 |
| Molecular Weight | 166.94 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | 1,4-dihydropyridine-2,3-dione;iron |
| SMILES | O=C1CC=CNC1=O.[Fe] |
| InChI | InChI=1S/C5H5NO2.Fe/c7-4-2-1-3-6-5(4)8;/h1,3H,2H2,(H,6,8); |
| InChIKey | OFAIPICMNYWHGI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.94 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydropyridine-2,3-dione;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydropyridine-2,3-dione;iron?
The IUPAC name of 1,4-dihydropyridine-2,3-dione;iron (CID 70276260) is 1,4-dihydropyridine-2,3-dione;iron.
What is the SMILES notation for 1,4-dihydropyridine-2,3-dione;iron?
The canonical SMILES for 1,4-dihydropyridine-2,3-dione;iron is O=C1CC=CNC1=O.[Fe].
What is the InChIKey of 1,4-dihydropyridine-2,3-dione;iron?
The InChIKey is OFAIPICMNYWHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.Fe/c7-4-2-1-3-6-5(4)8;/h1,3H,2H2,(H,6,8);.
What are the key properties of 1,4-dihydropyridine-2,3-dione;iron?
1,4-dihydropyridine-2,3-dione;iron has a molecular weight of 166.94 g/mol, XLogP of -0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydropyridine-2,3-dione;iron is sourced from PubChem (CID 70276260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).