C19H18N2O2 — CID 70276991
5-amino-3-[(2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]-1H-indol-2-one (PubChem CID 70276991) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-amino-3-[(2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-amino-3-[(2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 70276991 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-amino-3-[(2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]-1H-indol-2-one |
| SMILES | Nc1ccc2c(c1)C(=CC1c3ccccc3CCC1O)C(=O)N2 |
| InChI | InChI=1S/C19H18N2O2/c20-12-6-7-17-14(9-12)16(19(23)21-17)10-15-13-4-2-1-3-11(13)5-8-18(15)22/h1-4,6-7,9-10,15,18,22H,5,8,20H2,(H,21,23) |
| InChIKey | XSULIBVCNQHOHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|