C28H36N6O6S — CID 70277304
acetic acid;pyridin-2-ylmethyl 3-[[3-butyl-2-(4-carbamimidoylbenzoyl)imino-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate (PubChem CID 70277304) has the molecular formula C28H36N6O6S and a molecular weight of 584.70 g/mol. Its IUPAC name is acetic acid;pyridin-2-ylmethyl 3-[[3-butyl-2-(4-carbamimidoylbenzoyl)imino-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate.
| Compound Name | acetic acid;pyridin-2-ylmethyl 3-[[3-butyl-2-(4-carbamimidoylbenzoyl)imino-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70277304 |
| Molecular Formula | C28H36N6O6S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | acetic acid;pyridin-2-ylmethyl 3-[[3-butyl-2-(4-carbamimidoylbenzoyl)imino-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(C(=O)/N=C2/SC(C(=O)NCCC(=O)OCc3ccccn3)C(C)N2CCCC)cc1 |
| InChI | InChI=1S/C26H32N6O4S.C2H4O2/c1-3-4-15-32-17(2)22(25(35)30-14-12-21(33)36-16-20-7-5-6-13-29-20)37-26(32)31-24(34)19-10-8-18(9-11-19)23(27)28;1-2(3)4/h5-11,13,17,22H,3-4,12,14-16H2,1-2H3,(H3,27,28)(H,30,35);1H3,(H,3,4)/b31-26+; |
| InChIKey | YOBHRBMGYCWOTR-OVLKZKFTSA-N |
| XLogP | 2.81 |
| TPSA | 188.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|