C16H20Cl2N2O4S — CID 70277400
(Z)-2-(3,4-dichlorophenyl)-4-(4-methylsulfonyl-1,4-diazepan-1-yl)but-2-enoic acid (PubChem CID 70277400) has the molecular formula C16H20Cl2N2O4S and a molecular weight of 407.32 g/mol. Its IUPAC name is (Z)-2-(3,4-dichlorophenyl)-4-(4-methylsulfonyl-1,4-diazepan-1-yl)but-2-enoic acid.
| Compound Name | (Z)-2-(3,4-dichlorophenyl)-4-(4-methylsulfonyl-1,4-diazepan-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 70277400 |
| Molecular Formula | C16H20Cl2N2O4S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (Z)-2-(3,4-dichlorophenyl)-4-(4-methylsulfonyl-1,4-diazepan-1-yl)but-2-enoic acid |
| SMILES | CS(=O)(=O)N1CCCN(C/C=C(\C(=O)O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O4S/c1-25(23,24)20-7-2-6-19(9-10-20)8-5-13(16(21)22)12-3-4-14(17)15(18)11-12/h3-5,11H,2,6-10H2,1H3,(H,21,22)/b13-5- |
| InChIKey | FKTPGJKWHBAJTJ-ACAGNQJTSA-N |
| XLogP | 2.43 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|