C26H27FN4O4 — CID 70277554
1-O-ethyl 4-O-[2-[2-(4-fluoroanilino)pyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] butanedioate (PubChem CID 70277554) has the molecular formula C26H27FN4O4 and a molecular weight of 478.52 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-[2-(4-fluoroanilino)pyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] butanedioate.
| Compound Name | 1-O-ethyl 4-O-[2-[2-(4-fluoroanilino)pyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] butanedioate |
|---|---|
| PubChem CID | 70277554 |
| Molecular Formula | C26H27FN4O4 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 1-O-ethyl 4-O-[2-[2-(4-fluoroanilino)pyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] butanedioate |
| SMILES | CCOC(=O)CCC(=O)Oc1ccc2c(c1)C(C)N(c1ccnc(Nc3ccc(F)cc3)n1)CC2 |
| InChI | InChI=1S/C26H27FN4O4/c1-3-34-24(32)10-11-25(33)35-21-9-4-18-13-15-31(17(2)22(18)16-21)23-12-14-28-26(30-23)29-20-7-5-19(27)6-8-20/h4-9,12,14,16-17H,3,10-11,13,15H2,1-2H3,(H,28,29,30) |
| InChIKey | VMXRMMCRDYQLDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|