C28H32N2O3P+ — CID 70277555
dihydroxy(oxo)phosphanium;1-heptyl-2,4,5-triphenylimidazole (PubChem CID 70277555) has the molecular formula C28H32N2O3P+ and a molecular weight of 475.55 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-heptyl-2,4,5-triphenylimidazole.
| Compound Name | dihydroxy(oxo)phosphanium;1-heptyl-2,4,5-triphenylimidazole |
|---|---|
| PubChem CID | 70277555 |
| Molecular Formula | C28H32N2O3P+ |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-heptyl-2,4,5-triphenylimidazole |
| SMILES | CCCCCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1-c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C28H30N2.HO3P/c1-2-3-4-5-15-22-30-27(24-18-11-7-12-19-24)26(23-16-9-6-10-17-23)29-28(30)25-20-13-8-14-21-25;1-4(2)3/h6-14,16-21H,2-5,15,22H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | WPGNSSFUSIWOMN-UHFFFAOYSA-O |
| XLogP | 7.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|